6-BENZYL-3,4,5,6,7,8-HEXAHYDRO-1,6-NAPHTHYRIDIN-2(1H)-ONE structure
|
Common Name | 6-BENZYL-3,4,5,6,7,8-HEXAHYDRO-1,6-NAPHTHYRIDIN-2(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 210539-03-0 | Molecular Weight | 242.31600 | |
| Density | 1.185g/cm3 | Boiling Point | 464.1ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.479ºC | |
| Name | 6-benzyl-1,3,4,5,7,8-hexahydro-1,6-naphthyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 464.1ºC at 760 mmHg |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.31600 |
| Flash Point | 234.479ºC |
| Exact Mass | 242.14200 |
| PSA | 35.83000 |
| LogP | 2.27020 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | SZWKETFREPZUDD-UHFFFAOYSA-N |
| SMILES | O=C1CCC2=C(CCN(Cc3ccccc3)C2)N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-benzyl-3,4,5,6,7,8-hexahydro-1,6-naphthyridin-2(1H)-one |