3-(5-phenyltetrazol-2-yl)propanoic acid structure
|
Common Name | 3-(5-phenyltetrazol-2-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 21054-67-1 | Molecular Weight | 218.21200 | |
| Density | 1.39g/cm3 | Boiling Point | 465.7ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | 3-(5-phenyltetrazol-2-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 465.7ºC at 760 mmHg |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Flash Point | 235.5ºC |
| Exact Mass | 218.08000 |
| PSA | 80.90000 |
| LogP | 0.81480 |
| Vapour Pressure | 1.79E-09mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | GLOFATPXSACMFD-UHFFFAOYSA-N |
| SMILES | O=C(O)CCn1nnc(-c2ccccc2)n1 |
| HS Code | 2933990090 |
|---|
|
~54%
3-(5-phenyltetr... CAS#:21054-67-1 |
| Literature: Esikov; Zubarev; Bezklubnaya; Malin; Ostrovskii Chemistry of Heterocyclic Compounds, 2002 , vol. 38, # 8 p. 986 - 991 |
|
~%
3-(5-phenyltetr... CAS#:21054-67-1 |
| Literature: Esikov; Zubarev; Bezklubnaya; Malin; Ostrovskii Chemistry of Heterocyclic Compounds, 2002 , vol. 38, # 8 p. 986 - 991 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2628L11 |
| 5-phenyl-2H-tetrazole-2-propionic acid |
| 5-phenyltetrazol-2-ylpropanoic acid |