Ethyl 3-amino-6-chloro-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 3-amino-6-chloro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 210571-49-6 | Molecular Weight | 238.67000 | |
| Density | 1.399g/cm3 | Boiling Point | 430.7ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | Ethyl 3-amino-6-chloro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 430.7ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67000 |
| Flash Point | 214.3ºC |
| Exact Mass | 238.05100 |
| PSA | 68.11000 |
| LogP | 3.16140 |
| Vapour Pressure | 1.27E-07mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | DZOWEBWRGGYLFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)ccc2c1N |
| HS Code | 2933990090 |
|---|
|
~79%
Ethyl 3-amino-6... CAS#:210571-49-6 |
| Literature: Alkan, Sefik S.; Dinerstein, Robert J.; Hrib, Nicholas J.; Subramaniam, Arun; Jurcak, John G. Patent: US2004/6123 A1, 2004 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Amino-6-chloro-1H-indole-2-carboxylic acid,ethyl ester |