methyl 4-(3-ethoxycarbonyloxy-12-hydroxy-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate structure
|
Common Name | methyl 4-(3-ethoxycarbonyloxy-12-hydroxy-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 21059-40-5 | Molecular Weight | 492.64500 | |
| Density | 1.16g/cm3 | Boiling Point | 595.9ºC at 760mmHg | |
| Molecular Formula | C28H44O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | methyl 4-(3-ethoxycarbonyloxy-12-hydroxy-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 595.9ºC at 760mmHg |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.64500 |
| Flash Point | 188ºC |
| Exact Mass | 492.30900 |
| PSA | 99.13000 |
| LogP | 4.92610 |
| Vapour Pressure | 1.1E-16mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | JSTLLHLKEQTGOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC1CCC2(C)C(CC(=O)C3C2CC(O)C2(C)C(C(C)CCC(=O)OC)CCC32)C1 |
|
~83%
methyl 4-(3-eth... CAS#:21059-40-5 |
| Literature: Kasal, Alexander; Kohout, Ladislav; Lebl, Michal Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 12 p. 2147 - 2155 |
|
~%
methyl 4-(3-eth... CAS#:21059-40-5 |
| Literature: Kasal, Alexander; Kohout, Ladislav; Lebl, Michal Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 12 p. 2147 - 2155 |
|
~%
methyl 4-(3-eth... CAS#:21059-40-5 |
| Literature: Fieser; Rajagopalan Journal of the American Chemical Society, 1949 , vol. 71, p. 3938,3940 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |