Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate
Modify Date: 2025-09-09 19:36:05
Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate structure
|
Common Name | Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate | ||
|---|---|---|---|---|
| CAS Number | 21066-23-9 | Molecular Weight | 643.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H49NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C39H49NO7 |
|---|---|
| Molecular Weight | 643.8 |
| InChIKey | IWUOZBAOWPLSMW-XWYQRTICSA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(=NO)CC4CC(OC(=O)c5ccccc5)CCC4(C)C3CC(OC(=O)c3ccccc3)C12C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: The English name of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate. |
| Q: What is the InChIKey of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: InChIKey of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is IWUOZBAOWPLSMW-XWYQRTICSA-N. |
| Q: What is the Chinese name of 21066-23-9? |
| A: Chinese name of 21066-23-9 is 21066-23-9. |
| Q: What is the molecular formula of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: Molecular formula of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is C39H49NO7. |
| Q: What is the SMILES notation of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: SMILES notation of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is COC(=O)CCC(C)C1CCC2C3C(=NO)CC4CC(OC(=O)c5ccccc5)CCC4(C)C3CC(OC(=O)c3ccccc3)C12C. |
| Q: What is the molecular weight of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: Molecular weight of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is 643.8. |
| Q: What is the CAS number of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate? |
| A: CAS number of Methyl 3alpha,12alpha-dibenzoyloxy-7-hydroxyimino-5beta-cholanate is 21066-23-9. |