2-(1-naphthylmethyl)malonic acid diethyl ester structure
|
Common Name | 2-(1-naphthylmethyl)malonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2107-84-8 | Molecular Weight | 300.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-naphthylmethyl)malonic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20O4 |
|---|---|
| Molecular Weight | 300.34900 |
| Exact Mass | 300.13600 |
| PSA | 52.60000 |
| LogP | 3.12470 |
| InChIKey | IXXYPVAENVSLGU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1cccc2ccccc12)C(=O)OC |
| HS Code | 2917399090 |
|---|
|
~%
2-(1-naphthylme... CAS#:2107-84-8 |
| Literature: Fieser; Gates Journal of the American Chemical Society, 1940 , vol. 62, p. 2335,2339 |
|
~%
2-(1-naphthylme... CAS#:2107-84-8 |
| Literature: Mayer,F.; Sieglitz Chemische Berichte, 1922 , vol. 55, p. 1854 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-naphthalen-1-ylmethylmalonic acid diethyl ester |
| α-naphthylmethylmalonic acid diethyl ester |
| diethyl (1-naphthylmethylen)malonate |
| diethyl (1-naphthylmethyl)propanedioate |
| diethyl (1-naphthylmethyl)malonate |
| ethyl (1-naphthylmethyl)malonate |