1-anilino-3-methyl-1-phenylthiourea
1-anilino-3-methyl-1-phenylthiourea structure
|
Common Name | 1-anilino-3-methyl-1-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 21075-68-3 | Molecular Weight | 257.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-anilino-3-methyl-1-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15N3S |
|---|---|
| Molecular Weight | 257.35400 |
| Exact Mass | 257.09900 |
| PSA | 66.43000 |
| LogP | 3.50870 |
| InChIKey | WMKKDYFQMQANJM-UHFFFAOYSA-N |
| SMILES | CNC(=S)N(Nc1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-anilino-3-met... CAS#:21075-68-3 |
| Literature: Jensen,K.A. et al. Acta Chemica Scandinavica (1947-1973), 1968 , vol. 22, p. 1 - 50 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methyl-1.2-diphenyl-thiosemicarbazid |
| Hydrazinecarbothioamide,N-methyl-1,2-diphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 21075-68-3? |
| A: Chinese name of 21075-68-3 is 21075-68-3. |
| Q: What is the LogP of 1-anilino-3-methyl-1-phenylthiourea? |
| A: LogP of 1-anilino-3-methyl-1-phenylthiourea is 3.50870. |
| Q: What is the molecular weight of 1-anilino-3-methyl-1-phenylthiourea? |
| A: Molecular weight of 1-anilino-3-methyl-1-phenylthiourea is 257.35400. |
| Q: What is the CAS number of 1-anilino-3-methyl-1-phenylthiourea? |
| A: CAS number of 1-anilino-3-methyl-1-phenylthiourea is 21075-68-3. |
| Q: What are the upstream materials of 1-anilino-3-methyl-1-phenylthiourea? |
| A: Related upstream materials(CAS) of 1-anilino-3-methyl-1-phenylthiourea: 556-61-6;122-66-7. |
| Q: What is the molecular formula of 1-anilino-3-methyl-1-phenylthiourea? |
| A: Molecular formula of 1-anilino-3-methyl-1-phenylthiourea is C14H15N3S. |
| Q: What is the InChIKey of 1-anilino-3-methyl-1-phenylthiourea? |
| A: InChIKey of 1-anilino-3-methyl-1-phenylthiourea is WMKKDYFQMQANJM-UHFFFAOYSA-N. |
| Q: What is the English name of 1-anilino-3-methyl-1-phenylthiourea? |
| A: The English name of 1-anilino-3-methyl-1-phenylthiourea is 1-anilino-3-methyl-1-phenylthiourea. |
| Q: What is the polar surface area (PSA) of 1-anilino-3-methyl-1-phenylthiourea? |
| A: Polar surface area (PSA) of 1-anilino-3-methyl-1-phenylthiourea is 66.43000. |
| Q: What English synonyms does 1-anilino-3-methyl-1-phenylthiourea have? |
| A: English synonyms of 1-anilino-3-methyl-1-phenylthiourea: 4-Methyl-1.2-diphenyl-thiosemicarbazid, Hydrazinecarbothioamide,N-methyl-1,2-diphenyl. |