Pentamethylene Bis[4-(10,15,20-triphenylporphyrin-5-yl)benzoate]dizinc(II) [Reagent for application of the exciton chirality Method] structure
|
Common Name | Pentamethylene Bis[4-(10,15,20-triphenylporphyrin-5-yl)benzoate]dizinc(II) [Reagent for application of the exciton chirality Method] | ||
|---|---|---|---|---|
| CAS Number | 210769-64-5 | Molecular Weight | 1512.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C95H64N8O4Zn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentamethylene bis[4-(10,15,20-triphenylporphin-5-yl)benzoate]dizinc(II) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C95H64N8O4Zn2 |
|---|---|
| Molecular Weight | 1512.34000 |
| Exact Mass | 1508.36000 |
| PSA | 92.04000 |
| LogP | 10.75530 |
| InChIKey | NBWTUFLOLJEGJZ-UHFFFAOYSA-L |
| SMILES | O=C(OCCCCCOC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2].[Zn+2] |
| Pentamethylene Bis[4-(10,15,20-triphenylporphin-5-yl)benzoate]dizinc(II) |
| Pentamethylene Bis[4-(10,15,20-triphenylporphyrin-5-yl)benzoate]dizinc(II) |
| Pentamethylene Bis[4-(10,15,20-triphenylporphYHin-5-yl)benzoate]dizinc(II) |