2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone structure
|
Common Name | 2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 210832-86-3 | Molecular Weight | 292.17100 | |
| Density | 1.416g/cm3 | Boiling Point | 415.4ºC at 760mmHg | |
| Molecular Formula | C14H14BrNO | Melting Point | 117-120ºC | |
| MSDS | N/A | Flash Point | 205ºC | |
Use of 2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanoneBADAN (6-Bromoacetyl-2-dimethylaminonaphthalene) is a polarity-sensitive fluorescent probe[1]. |
| Name | 2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | BADAN (6-Bromoacetyl-2-dimethylaminonaphthalene) is a polarity-sensitive fluorescent probe[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 415.4ºC at 760mmHg |
| Melting Point | 117-120ºC |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.17100 |
| Flash Point | 205ºC |
| Exact Mass | 291.02600 |
| PSA | 20.31000 |
| LogP | 3.48340 |
| Vapour Pressure | 4.13E-07mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | ZEIHZWQYRTVVMA-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2cc(C(=O)CBr)ccc2c1 |
|
~92%
2-bromo-1-[6-(d... CAS#:210832-86-3 |
| Literature: Diwu, Zhenjun; Beachdel, Christopher; Klaubert, Dieter H. Tetrahedron Letters, 1998 , vol. 39, # 28 p. 4987 - 4990 |
|
~%
2-bromo-1-[6-(d... CAS#:210832-86-3 |
| Literature: Chemical communications (Cambridge, England), , # 17 p. 1912 - 1913 |
|
~%
2-bromo-1-[6-(d... CAS#:210832-86-3 |
| Literature: Chemical communications (Cambridge, England), , # 17 p. 1912 - 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BADAN |
| 6-bromoacetyl-2-dimethylaminonaphthalene |