7-Deoxy Daunorubicinol Aglycone structure
|
Common Name | 7-Deoxy Daunorubicinol Aglycone | ||
|---|---|---|---|---|
| CAS Number | 210837-87-9 | Molecular Weight | 384.37900 | |
| Density | 1.506g/cm3 | Boiling Point | 693.337ºC at 760 mmHg | |
| Molecular Formula | C21H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.706ºC | |
| Name | (9R)-6,9,11-trihydroxy-9-(1-hydroxyethyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 693.337ºC at 760 mmHg |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.37900 |
| Flash Point | 249.706ºC |
| Exact Mass | 384.12100 |
| PSA | 124.29000 |
| LogP | 1.48240 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | FCGIQQFXNIJXMK-SSKGYDFUSA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(C)O)CC3 |
|
~%
7-Deoxy Daunoru... CAS#:210837-87-9 |
| Literature: Journal of the American Chemical Society, , vol. 114, # 1 p. 242 - 248 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-deoxy-13-dihydrodaunomycinone |
| 7-Deoxy-daunorubicinologlycon |
| 7-deoxydaunomycinol |