diethoxy-(2-phenylethynylsulfanyl)-sulfanylidene-λ5-phosphane structure
|
Common Name | diethoxy-(2-phenylethynylsulfanyl)-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 21099-04-7 | Molecular Weight | 286.35000 | |
| Density | 1.23g/cm3 | Boiling Point | 361.8ºC at 760 mmHg | |
| Molecular Formula | C12H15O2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | diethoxy-(2-phenylethynylsulfanyl)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760 mmHg |
| Molecular Formula | C12H15O2PS2 |
| Molecular Weight | 286.35000 |
| Flash Point | 172.6ºC |
| Exact Mass | 286.02500 |
| PSA | 85.66000 |
| LogP | 4.67690 |
| Vapour Pressure | 4.21E-05mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | VEJDOFOWOWAMCE-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC#Cc1ccccc1 |
|
~82%
diethoxy-(2-phe... CAS#:21099-04-7 |
| Literature: Liu, Zu-Dong; Chen, Zhen-Chu Journal of Organic Chemistry, 1993 , vol. 58, # 7 p. 1924 - 1925 |
|
~%
diethoxy-(2-phe... CAS#:21099-04-7 |
| Literature: Miller,B. Tetrahedron, 1964 , vol. 20, p. 2069 - 2078 |
| O,O-Diethyl-S-phenyl-ethinyl-phosphordithioester |
| O,O-Diethyl-S-phenylethinyldithiophosphat |