Methyl 5,7-dimethylchromane-3-carboxylate
Modify Date: 2026-07-22 07:39:16
Methyl 5,7-dimethylchromane-3-carboxylate structure
|
Common Name | Methyl 5,7-dimethylchromane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2109966-52-9 | Molecular Weight | 220.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5,7-dimethylchromane-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26 |
| InChIKey | KEEDBVJZUOYZPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1COc2cc(C)cc(C)c2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: The English name of Methyl 5,7-dimethylchromane-3-carboxylate is Methyl 5,7-dimethylchromane-3-carboxylate. |
| Q: What is the CAS number of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: CAS number of Methyl 5,7-dimethylchromane-3-carboxylate is 2109966-52-9. |
| Q: What is the molecular weight of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: Molecular weight of Methyl 5,7-dimethylchromane-3-carboxylate is 220.26. |
| Q: What is the molecular formula of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: Molecular formula of Methyl 5,7-dimethylchromane-3-carboxylate is C13H16O3. |
| Q: What is the Chinese name of 2109966-52-9? |
| A: Chinese name of 2109966-52-9 is COC(=O)C1COc2cc(C)cc(C)c2C1. |
| Q: What is the InChIKey of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: InChIKey of Methyl 5,7-dimethylchromane-3-carboxylate is KEEDBVJZUOYZPU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 5,7-dimethylchromane-3-carboxylate? |
| A: SMILES notation of Methyl 5,7-dimethylchromane-3-carboxylate is COC(=O)C1COc2cc(C)cc(C)c2C1. |