7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine structure
|
Common Name | 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2110589-10-9 | Molecular Weight | 193.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO2 |
|---|---|
| Molecular Weight | 193.24 |
| InChIKey | GOUSJFNLDQWBND-UHFFFAOYSA-N |
| SMILES | c1cc2c(o1)C(C1CCOC1)NCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: SMILES notation of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is c1cc2c(o1)C(C1CCOC1)NCC2. |
| Q: What is the molecular formula of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: Molecular formula of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is C11H15NO2. |
| Q: What is the InChIKey of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: InChIKey of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is GOUSJFNLDQWBND-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2110589-10-9? |
| A: Chinese name of 2110589-10-9 is 2110589-10-9. |
| Q: What is the molecular weight of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: Molecular weight of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 193.24. |
| Q: What is the English name of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: The English name of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine. |
| Q: What is the CAS number of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine? |
| A: CAS number of 7-(oxolan-3-yl)-4H,5H,6H,7H-furo[2,3-c]pyridine is 2110589-10-9. |