17-trans Prostaglandin F3α structure
|
Common Name | 17-trans Prostaglandin F3α | ||
|---|---|---|---|---|
| CAS Number | 211100-24-2 | Molecular Weight | 352.465 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 541.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.4±26.6 °C | |
Use of 17-trans Prostaglandin F3α17-trans Prostaglandin F3α is a double bond isomer of PGF3α and a potential metabolite of trans dietary fatty acids. |
| Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxyocta-1,5-dienyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.7±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.465 |
| Flash Point | 295.4±26.6 °C |
| Exact Mass | 352.224976 |
| PSA | 97.99000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | SAKGBZWJAIABSY-XYJRQBLTSA-N |
| SMILES | CCC=CCC(O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O |
| (5E,9α,11α,13E,17E)-9,11,15-Trihydroxyprosta-5,13,17-trien-1-oic acid |
| 17-trans Prostaglandin F3alpha |
| (5Z,9α,11α,13E,15S,17E)-9,11,15-Trihydroxyprosta-5,13,17-trien-1-oic acid |
| Prosta-5,13,17-trien-1-oic acid, 9,11,15-trihydroxy-, (5Z,9α,11α,13E,15S,17E)- |
| Prosta-5,13,17-trien-1-oic acid, 9,11,15-trihydroxy-, (5E,9α,11α,13E,17E)- |