1-nitro-4-[(4-nitrophenyl)-phenylmethyl]benzene structure
|
Common Name | 1-nitro-4-[(4-nitrophenyl)-phenylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 21112-02-7 | Molecular Weight | 334.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-[(4-nitrophenyl)-phenylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14N2O4 |
|---|---|
| Molecular Weight | 334.32500 |
| Exact Mass | 334.09500 |
| PSA | 91.64000 |
| LogP | 5.72960 |
| InChIKey | CCWAGSQBYBVMFW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-nitro-4-[(4-n... CAS#:21112-02-7 |
| Literature: Adley,T.J.; Clarke,D.R. Canadian Journal of Chemistry, 1969 , vol. 47, p. 505 - 508 |
|
~%
1-nitro-4-[(4-n... CAS#:21112-02-7 |
| Literature: Fogel, Paula; Farrel, Patrick G.; Lelievre, Jacques; Chatrousse, Alain P.; Terrier, Francois Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 711 - 716 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-dinitrotriphenylmethane |
| 4,4'-Dinitro-triphenylmethan |