N-(2,4-dichlorophenyl)-2-(2,3-dimethylanilino)benzamide structure
|
Common Name | N-(2,4-dichlorophenyl)-2-(2,3-dimethylanilino)benzamide | ||
|---|---|---|---|---|
| CAS Number | 21122-58-7 | Molecular Weight | 385.28600 | |
| Density | 1.324g/cm3 | Boiling Point | 455.8ºC at 760 mmHg | |
| Molecular Formula | C21H18Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | N-(2,4-dichlorophenyl)-2-(2,3-dimethylanilino)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 455.8ºC at 760 mmHg |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.28600 |
| Flash Point | 229.5ºC |
| Exact Mass | 384.08000 |
| PSA | 44.62000 |
| LogP | 7.06310 |
| Vapour Pressure | 1.71E-08mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | RPUUCIAEFIZOQN-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)Nc2ccc(Cl)cc2Cl)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzanilide,2',4'-dichloro-2-(2,3-xylidino) |
| 2.3-Dimethyl-2'-(2.4-dichlor-phenylcarbamoyl)-diphenylamin |
| N-(2,4-Dichlorophenyl)-2-((2,3-dimethylphenyl)amino)benzamide |
| Benzamide,N-(2,4-dichlorophenyl)-2-((2,3-dimethylphenyl)amino) |