Phenol, 3-methoxy-,1-(N-phenylcarbamate) structure
|
Common Name | Phenol, 3-methoxy-,1-(N-phenylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 21123-19-3 | Molecular Weight | 243.25800 | |
| Density | 1.226g/cm3 | Boiling Point | 358.8ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | (3-methoxyphenyl) N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 358.8ºC at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 170.8ºC |
| Exact Mass | 243.09000 |
| PSA | 47.56000 |
| LogP | 3.37910 |
| Vapour Pressure | 2.48E-05mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | VUQBKMUXPJXMQT-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC(=O)Nc2ccccc2)c1 |
|
~%
Phenol, 3-metho... CAS#:21123-19-3 |
| Literature: Leffler; Matson Journal of the American Chemical Society, 1948 , vol. 70, p. 3439,3440,3441 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| m-Methoxyphenylphenylurethan |
| m-Methoxyphenyl-carbanilat |
| 3-methoxyphenyl phenylcarbamate |
| N-Phenyl-carbaminsaeure-<3-methoxy-phenylester> |