1,1-Propanediol,2-phenyl-, 1,1-diacetate structure
|
Common Name | 1,1-Propanediol,2-phenyl-, 1,1-diacetate | ||
|---|---|---|---|---|
| CAS Number | 21129-06-6 | Molecular Weight | 236.26400 | |
| Density | 1.109g/cm3 | Boiling Point | 314.9ºC at 760mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | (1-acetyloxy-2-phenyl-propyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 314.9ºC at 760mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 150.5ºC |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 2.24240 |
| Vapour Pressure | 0.000453mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | ZBGDNICKLCRTBW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)C(C)c1ccccc1 |
| HS Code | 2915390090 |
|---|
|
~91%
1,1-Propanediol... CAS#:21129-06-6 |
| Literature: Shirini; Mamaghani; Mostashari-Rad; Abedini Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 8 p. 2399 - 2401 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-phenylpropane-1,1-diyl diacetate |
| 2-Phenyl-1.1-diacetoxy-propan |