2H-Pyrrol-2-one,3-acetyl-1,5-dihydro-4-hydroxy-5-(2-methylpropyl)- structure
|
Common Name | 2H-Pyrrol-2-one,3-acetyl-1,5-dihydro-4-hydroxy-5-(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 2113-88-4 | Molecular Weight | 197.23100 | |
| Density | 1.162g/cm3 | Boiling Point | 327.4ºC at 760 mmHg | |
| Molecular Formula | C10H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.8ºC | |
| Name | 4-acetyl-3-hydroxy-2-(2-methylpropyl)-1,2-dihydropyrrol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 327.4ºC at 760 mmHg |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23100 |
| Flash Point | 151.8ºC |
| Exact Mass | 197.10500 |
| PSA | 66.40000 |
| LogP | 1.26080 |
| Vapour Pressure | 1.54E-05mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | SHHAXAUQMPMPRV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(O)C(CC(C)C)NC1=O |
|
~67%
2H-Pyrrol-2-one... CAS#:2113-88-4 |
| Literature: Poncet, Joel; Jouin, Patrick; Castro, Bertrand; Nicolas, Louisette; Boutar, Mohamed; Gaudemer, Alain Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 611 - 616 |
|
~%
2H-Pyrrol-2-one... CAS#:2113-88-4 |
| Literature: Poncet, Joel; Jouin, Patrick; Castro, Bertrand; Nicolas, Louisette; Boutar, Mohamed; Gaudemer, Alain Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 611 - 616 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Acetyl-5-isobutyltetramsaeure |