3-acetyl-5-isopropyltetramic acid structure
|
Common Name | 3-acetyl-5-isopropyltetramic acid | ||
|---|---|---|---|---|
| CAS Number | 2113-91-9 | Molecular Weight | 183.20400 | |
| Density | 1.214g/cm3 | Boiling Point | 313.5ºC at 760mmHg | |
| Molecular Formula | C9H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | 4-acetyl-3-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760mmHg |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.20400 |
| Flash Point | 143.4ºC |
| Exact Mass | 183.09000 |
| PSA | 69.89000 |
| LogP | 0.81780 |
| Vapour Pressure | 4.3E-05mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | JYLWAPLSGOUVIV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(O)C(C(C)C)NC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Aipta |
| 3-Acetyl-5-isopropylpyrrolidin-2,4-dion |
| 3-Acetyl-5-isopropyltetramic acid |
| 4-acetyl-5-hydroxy-2-propan-2-yl-1,2-dihydropyrrol-3-one |