Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate
Modify Date: 2025-09-04 18:22:29
Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate structure
|
Common Name | Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 2113003-86-2 | Molecular Weight | 215.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11F2NO2 |
|---|---|
| Molecular Weight | 215.20 |
| InChIKey | CYMDVYWERBNELD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(F)c1ccccc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: InChIKey of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is CYMDVYWERBNELD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: Molecular weight of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is 215.20. |
| Q: What is the molecular formula of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: Molecular formula of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is C10H11F2NO2. |
| Q: What is the Chinese name of 2113003-86-2? |
| A: Chinese name of 2113003-86-2 is 2113003-86-2. |
| Q: What is the English name of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: The English name of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate. |
| Q: What is the CAS number of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: CAS number of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is 2113003-86-2. |
| Q: What is the SMILES notation of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate? |
| A: SMILES notation of Ethyl 2-(2-aminophenyl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1ccccc1N. |