4-Iodo-N-(4-{1-[(isopropylsulfonyl)amino]-2-propanyl}phenyl)benza mide structure
|
Common Name | 4-Iodo-N-(4-{1-[(isopropylsulfonyl)amino]-2-propanyl}phenyl)benza mide | ||
|---|---|---|---|---|
| CAS Number | 211313-57-4 | Molecular Weight | 486.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23IN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Iodo-N-(4-{1-[(isopropylsulfonyl)amino]-2-propanyl}phenyl)benza mide |
|---|
| Molecular Formula | C19H23IN2O3S |
|---|---|
| Molecular Weight | 486.36700 |
| Exact Mass | 486.04700 |
| PSA | 87.14000 |
| LogP | 5.83050 |
| InChIKey | ZYNJMBPSQLHENC-UHFFFAOYSA-N |
| SMILES | CC(CNS(=O)(=O)C(C)C)c1ccc(NC(=O)c2ccc(I)cc2)cc1 |
|
~75%
4-Iodo-N-(4-{1-... CAS#:211313-57-4 |
| Literature: Zarrinmayeh; Bleakman; Gates; Yu; Zimmerman; Ornstein; McKennon; Arnold; Wheeler; Skolnick Journal of medicinal chemistry, 2001 , vol. 44, # 3 p. 302 - 304 |
|
~%
4-Iodo-N-(4-{1-... CAS#:211313-57-4 |
| Literature: Zarrinmayeh; Bleakman; Gates; Yu; Zimmerman; Ornstein; McKennon; Arnold; Wheeler; Skolnick Journal of medicinal chemistry, 2001 , vol. 44, # 3 p. 302 - 304 |