4-(Trifluoromethyl)quinolin-2-amine structure
|
Common Name | 4-(Trifluoromethyl)quinolin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 211449-19-3 | Molecular Weight | 212.17100 | |
| Density | 1.39 | Boiling Point | 315ºC | |
| Molecular Formula | C10H7F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144ºC | |
| Name | 4-(Trifluoromethyl)quinolin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39 |
|---|---|
| Boiling Point | 315ºC |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.17100 |
| Flash Point | 144ºC |
| Exact Mass | 212.05600 |
| PSA | 38.91000 |
| LogP | 3.41700 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | UNRQZWDGGRFKTL-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD11046309 |