1-(3-methylbutyl)-N-(2-sulfanylphenyl)cyclohexane-1-carboxamide structure
|
Common Name | 1-(3-methylbutyl)-N-(2-sulfanylphenyl)cyclohexane-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 211513-22-3 | Molecular Weight | 305.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-methylbutyl)-N-(2-sulfanylphenyl)cyclohexane-1-carboxamide |
|---|
| Molecular Formula | C18H27NOS |
|---|---|
| Molecular Weight | 305.47800 |
| Exact Mass | 305.18100 |
| PSA | 71.39000 |
| LogP | 5.95000 |
| InChIKey | OBWOWYBSZTURFB-UHFFFAOYSA-N |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2S)CCCCC1 |
|
~%
1-(3-methylbuty... CAS#:211513-22-3 |
| Literature: Maeda, Kimiya; Okamoto, Hiroshi; Shinkai, Hisashi Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 10 p. 2589 - 2591 |
|
~%
1-(3-methylbuty... CAS#:211513-22-3 |
| Literature: Maeda, Kimiya; Okamoto, Hiroshi; Shinkai, Hisashi Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 10 p. 2589 - 2591 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |