2-(4-Bromophenyl)-1,3-thiazole-4-carbaldehyde structure
|
Common Name | 2-(4-Bromophenyl)-1,3-thiazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 21166-30-3 | Molecular Weight | 268.130 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 394.4±48.0 °C at 760 mmHg | |
| Molecular Formula | C10H6BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.3±29.6 °C | |
| Name | 2-(4-bromophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.4±48.0 °C at 760 mmHg |
| Molecular Formula | C10H6BrNOS |
| Molecular Weight | 268.130 |
| Flash Point | 192.3±29.6 °C |
| Exact Mass | 266.935333 |
| PSA | 58.20000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | KOMFNSXHHNSAFR-UHFFFAOYSA-N |
| SMILES | O=Cc1csc(-c2ccc(Br)cc2)n1 |
| HS Code | 2934100090 |
|---|
|
~%
2-(4-Bromopheny... CAS#:21166-30-3 |
| Literature: Archiv der Pharmazie, , vol. 343, # 7 p. 411 - 416 |
|
~%
2-(4-Bromopheny... CAS#:21166-30-3 |
| Literature: Archiv der Pharmazie, , vol. 343, # 7 p. 411 - 416 |
|
~%
2-(4-Bromopheny... CAS#:21166-30-3 |
| Literature: Archiv der Pharmazie, , vol. 343, # 7 p. 411 - 416 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(4-Bromophenyl)-1,3-thiazole-4-carbaldehyde |
| 4-Thiazolecarboxaldehyde, 2-(4-bromophenyl)- |
| 2-p-Brom-phenyl-4-formyl-thiazol |