triphenyltin-bis(diethyl)dithiophosphate structure
|
Common Name | triphenyltin-bis(diethyl)dithiophosphate | ||
|---|---|---|---|---|
| CAS Number | 2117-78-4 | Molecular Weight | 535.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25O2PS2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O,O-diethyl S-(triphenylstannyl) phosphorodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H25O2PS2Sn |
|---|---|
| Molecular Weight | 535.23700 |
| Exact Mass | 536.00600 |
| PSA | 85.66000 |
| LogP | 5.33480 |
| InChIKey | DFRKYUCCSIWZQP-UHFFFAOYSA-M |
| SMILES | CCOP(=S)(OCC)S[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| phosphorodithioic acid,o,o-diethyl s-(triphenylstannyl) ester |