Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine
Modify Date: 2025-09-02 20:54:31
![Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine Structure](https://www.chemsrc.com/extcaspic/031/2118959-59-2.png)
Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine structure
|
Common Name | Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine | ||
|---|---|---|---|---|
| CAS Number | 2118959-59-2 | Molecular Weight | 506.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H51OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C34H51OP |
|---|---|
| Molecular Weight | 506.7 |
| InChIKey | WYPVJWRYJCTQLU-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1P(C1CCCCC1)C1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: CAS number of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is 2118959-59-2. |
| Q: What is the SMILES notation of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: SMILES notation of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is COc1cccc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1P(C1CCCCC1)C1CCCCC1. |
| Q: What is the English name of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: The English name of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine. |
| Q: What is the InChIKey of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: InChIKey of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is WYPVJWRYJCTQLU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2118959-59-2? |
| A: Chinese name of 2118959-59-2 is 2118959-59-2. |
| Q: What is the molecular formula of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: Molecular formula of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is C34H51OP. |
| Q: What is the molecular weight of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine? |
| A: Molecular weight of Dicyclohexyl[3-methoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine is 506.7. |