3-[4-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl-trimethylazanium,dibromide structure
|
Common Name | 3-[4-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl-trimethylazanium,dibromide | ||
|---|---|---|---|---|
| CAS Number | 21199-25-7 | Molecular Weight | 483.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H29Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl-trimethylazanium,dibromide |
|---|
| Molecular Formula | C21H29Br2N3 |
|---|---|
| Molecular Weight | 483.28300 |
| Exact Mass | 481.07300 |
| PSA | 19.67000 |
| InChIKey | MWLHSMMCWPOORG-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCC[n+]1ccc(CCc2c[nH]c3ccccc23)cc1.[Br-].[Br-] |
| HS Code | 2933990090 |
|---|
|
~%
3-[4-[2-(1H-ind... CAS#:21199-25-7 |
| Literature: Gray et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 3805,3807 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |