5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid
Modify Date: 2025-09-09 16:07:37
![5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/115/2120078-10-4.png)
5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid structure
|
Common Name | 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2120078-10-4 | Molecular Weight | 321.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO5S |
|---|---|
| Molecular Weight | 321.3 |
| InChIKey | AEBYNIVBAPWYDN-UHFFFAOYSA-N |
| SMILES | O=C(CS(=O)Cc1ccc(C(=O)O)o1)NCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: SMILES notation of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is O=C(CS(=O)Cc1ccc(C(=O)O)o1)NCc1ccccc1. |
| Q: What is the InChIKey of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: InChIKey of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is AEBYNIVBAPWYDN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: Molecular weight of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is 321.3. |
| Q: What is the Chinese name of 2120078-10-4? |
| A: Chinese name of 2120078-10-4 is 2120078-10-4. |
| Q: What is the molecular formula of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: Molecular formula of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is C15H15NO5S. |
| Q: What is the CAS number of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: CAS number of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is 2120078-10-4. |
| Q: What is the English name of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid? |
| A: The English name of 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid is 5-{[(Benzylcarbamoyl)methanesulfinyl]methyl}furan-2-carboxylic acid. |