2,4,6-trimethyl-3-nitropyridine structure
|
Common Name | 2,4,6-trimethyl-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 21203-55-4 | Molecular Weight | 166.17700 | |
| Density | 1.159g/cm3 | Boiling Point | 254.1ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.4ºC | |
| Name | 2,4,6-trimethyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 254.1ºC at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Flash Point | 107.4ºC |
| Exact Mass | 166.07400 |
| PSA | 58.71000 |
| LogP | 2.43820 |
| Vapour Pressure | 0.0282mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | UQBHNBZGFVDCAH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)n1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-2,4,6-collidin |
| 2,4,6-trimethyl-3-nitro-pyridine |
| 3-Nitro-s-kollidin |
| 3-Nitro-collidin |
| 3-nitro-2,4,6-trimethylpyridine |
| 2,4,6-Trimethyl-3-nitro-pyridin |
| 3-nitro-2,4,6-collidine |