2-Nitro-1-phenylethan-1-one oxime structure
|
Common Name | 2-Nitro-1-phenylethan-1-one oxime | ||
|---|---|---|---|---|
| CAS Number | 21205-24-3 | Molecular Weight | 180.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Nitro-1-phenylethan-1-one oxime |
|---|
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16100 |
| Exact Mass | 180.05300 |
| PSA | 78.41000 |
| LogP | 1.66480 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | VZXWHAIIKCIOBN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(=NO)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |