Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate
Modify Date: 2025-10-26 19:24:49
![Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate Structure](https://www.chemsrc.com/extcaspic/119/2120759-33-1.png)
Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate structure
|
Common Name | Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 2120759-33-1 | Molecular Weight | 267.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO5 |
|---|---|
| Molecular Weight | 267.28 |
| InChIKey | KQNQMCHALXBQKV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(O)c1NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: The English name of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate. |
| Q: What is the molecular weight of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: Molecular weight of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is 267.28. |
| Q: What is the InChIKey of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: InChIKey of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is KQNQMCHALXBQKV-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: CAS number of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is 2120759-33-1. |
| Q: What is the Chinese name of 2120759-33-1? |
| A: Chinese name of 2120759-33-1 is 2120759-33-1. |
| Q: What is the SMILES notation of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: SMILES notation of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is COC(=O)c1cccc(O)c1NC(=O)OC(C)(C)C. |
| Q: What is the molecular formula of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate? |
| A: Molecular formula of Methyl 2-{[(tert-butoxy)carbonyl]amino}-3-hydroxybenzoate is C13H17NO5. |