Carbamic acid,N-[4-(chlorosulfonyl)phenyl]-, ethyl ester structure
|
Common Name | Carbamic acid,N-[4-(chlorosulfonyl)phenyl]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21208-62-8 | Molecular Weight | 263.69800 | |
| Density | 1.448g/cm3 | Boiling Point | 328.9ºC at 760 mmHg | |
| Molecular Formula | C9H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.7ºC | |
| Name | 4-ethoxycarbonylamino-benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 328.9ºC at 760 mmHg |
| Molecular Formula | C9H10ClNO4S |
| Molecular Weight | 263.69800 |
| Flash Point | 152.7ºC |
| Exact Mass | 263.00200 |
| PSA | 80.85000 |
| LogP | 3.33630 |
| Vapour Pressure | 0.000183mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | QIJQSTNYYPTNBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)Cl)cc1 |
|
~73%
Carbamic acid,N... CAS#:21208-62-8 |
| Literature: Rosevear, Judi; Wilshire, John F. K. Australian Journal of Chemistry, 1982 , vol. 35, # 8 p. 1727 - 1732 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| N-Aethoxycarbonyl-sulfanilylchlorid |
| 4-chlorosulfonyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid ethyl ester |
| N-ethoxycarbonyl-sulfanilyl chloride |