2-[4-(4-Methoxycyclohexyl)butyl]aminoethanethiol sulfate structure
|
Common Name | 2-[4-(4-Methoxycyclohexyl)butyl]aminoethanethiol sulfate | ||
|---|---|---|---|---|
| CAS Number | 21209-07-4 | Molecular Weight | 273.28400 | |
| Density | 1.2g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Exact Mass | 273.10000 |
| PSA | 55.84000 |
| LogP | 1.42700 |
| Index of Refraction | 1.532 |
| InChIKey | PKZSSJLCJOHCSM-UHFFFAOYSA-N |
| SMILES | COC1CCC(CCCCNCCSS(=O)(=O)O)CC1 |
|
~%
2-[4-(4-Methoxy... CAS#:21209-07-4 |
| Literature: Parke, Davis and Co. Patent: US3408381 , 1968 ; Chem.Abstr., 1969 , vol. 70, # 87143 |
|
~%
2-[4-(4-Methoxy... CAS#:21209-07-4 |
| Literature: Parke, Davis and Co. Patent: US3408381 , 1968 ; Chem.Abstr., 1969 , vol. 70, # 87143 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |