juvenile hormone II structure
|
Common Name | juvenile hormone II | ||
|---|---|---|---|---|
| CAS Number | 21213-74-1 | Molecular Weight | 280.40200 | |
| Density | 0.956g/cm3 | Boiling Point | 364.2ºC at 760 mmHg | |
| Molecular Formula | C17H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.2ºC | |
| Name | methyl (2E,6E)-9-(3-ethyl-3-methyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.956g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760 mmHg |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.40200 |
| Flash Point | 152.2ºC |
| Exact Mass | 280.20400 |
| PSA | 38.83000 |
| LogP | 4.17990 |
| Vapour Pressure | 1.71E-05mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | CPVQJXZBSGXTGJ-LMLHBTEYSA-N |
| SMILES | CCC1(C)OC1CCC(C)=CCCC(C)=CC(=O)OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Carbazol-9-yl-3-diethylamino-propan-2-ol |