N,N-diphenyl-N,N-bis(1-phenylethylideneamino)butane-1,4-diamine structure
|
Common Name | N,N-diphenyl-N,N-bis(1-phenylethylideneamino)butane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 21219-01-2 | Molecular Weight | 474.63900 | |
| Density | 1.02g/cm3 | Boiling Point | 618ºC at 760mmHg | |
| Molecular Formula | C32H34N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.6ºC | |
| Name | N,N'-diphenyl-N,N'-bis[(Z)-1-phenylethylideneamino]butane-1,4-diamine |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 618ºC at 760mmHg |
| Molecular Formula | C32H34N4 |
| Molecular Weight | 474.63900 |
| Flash Point | 327.6ºC |
| Exact Mass | 474.27800 |
| PSA | 31.20000 |
| LogP | 7.62820 |
| Vapour Pressure | 3.34E-15mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | GXMHQWLRHZPXTR-YSBSNMNTSA-N |
| SMILES | CC(=NN(CCCCN(N=C(C)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
|
~%
N,N-diphenyl-N,... CAS#:21219-01-2 |
| Literature: Henoch,F.E.; Hauser,C.R. Canadian Journal of Chemistry, 1969 , vol. 47, p. 157 - 160 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |