N-(2-bromophenyl)benzenesulfonamide structure
|
Common Name | N-(2-bromophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 21226-31-3 | Molecular Weight | 312.18200 | |
| Density | 1.603g/cm3 | Boiling Point | 420.6ºC at 760mmHg | |
| Molecular Formula | C12H10BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | N-(2-bromophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 420.6ºC at 760mmHg |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.18200 |
| Flash Point | 208.2ºC |
| Exact Mass | 310.96200 |
| PSA | 54.55000 |
| LogP | 4.40370 |
| InChIKey | LBMJQGDIAXELFQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1Br)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~83%
N-(2-bromopheny... CAS#:21226-31-3 |
| Literature: Boger,D.L.; Coleman,R.S. Journal of the American Chemical Society, 1988 , vol. 110, p. 4796 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-bromo-N-benzenesulfonylaniline |