N-(3,5-Dichlorophenyl)-2-[(2,3-dimethylphenyl)amino]benzamide structure
|
Common Name | N-(3,5-Dichlorophenyl)-2-[(2,3-dimethylphenyl)amino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 21239-96-3 | Molecular Weight | 385.28600 | |
| Density | 1.324g/cm3 | Boiling Point | 456.7ºC at 760 mmHg | |
| Molecular Formula | C21H18Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | N-(3,5-Dichlorophenyl)-2-[(2,3-dimethylphenyl)amino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760 mmHg |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.28600 |
| Flash Point | 230ºC |
| Exact Mass | 384.08000 |
| PSA | 44.62000 |
| LogP | 7.06310 |
| Vapour Pressure | 1.58E-08mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | ODXLMPVQSVEPFS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)Nc2cc(Cl)cc(Cl)c2)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.3-Dimethyl-2'-(3.5-dichlor-phenylcarbamoyl)-diphenylamin |
| Benzanilide,3',4'-dichloro-2-(2,3-xylidino) |
| Benzamide,N-(3,4-dichlorophenyl)-2-((2,3-dimethylphenyl)amino) |
| 2.3-Dimethyl-2'-(3.4-dichlor-phenylcarbamoyl)-diphenylamin |
| n-(3,4-dichlorophenyl)-2-[(2,3-dimethylphenyl)amino]benzamide |