1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane
Modify Date: 2026-07-31 13:12:03
1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane structure
|
Common Name | 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane | ||
|---|---|---|---|---|
| CAS Number | 2124706-76-7 | Molecular Weight | 258.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N2O2S |
|---|---|
| Molecular Weight | 258.38 |
| InChIKey | PEXSSNIAFAGATC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(C1CC1)N1CCCN(C2CCC2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: Molecular weight of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is 258.38. |
| Q: What is the Chinese name of 2124706-76-7? |
| A: Chinese name of 2124706-76-7 is 2124706-76-7. |
| Q: What is the CAS number of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: CAS number of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is 2124706-76-7. |
| Q: What is the InChIKey of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: InChIKey of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is PEXSSNIAFAGATC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: Molecular formula of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is C12H22N2O2S. |
| Q: What is the English name of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: The English name of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane. |
| Q: What is the SMILES notation of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane? |
| A: SMILES notation of 1-Cyclobutyl-4-(cyclopropylsulfonyl)-1,4-diazepane is O=S(=O)(C1CC1)N1CCCN(C2CCC2)CC1. |