2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1) structure
|
Common Name | 2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2126-91-2 | Molecular Weight | 306.29200 | |
| Density | 1.344 g/cm3 | Boiling Point | 466.556ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.965ºC | |
| Name | 2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344 g/cm3 |
|---|---|
| Boiling Point | 466.556ºC at 760 mmHg |
| Molecular Formula | C10H14N2O7S |
| Molecular Weight | 306.29200 |
| Flash Point | 235.965ºC |
| Exact Mass | 306.05200 |
| PSA | 189.39000 |
| LogP | 1.96300 |
| Vapour Pressure | 1.66E-09mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | KAXRWMOLNJZCEW-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)CC(N)C(=O)O.O=S(=O)(O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| D,L-kynurenine sulfate salt |
| DL-Kynurenin,Sulfat |
| D,L-kynurenine sulfate |
| DL-kynurenin,sulfate |
| KN sulfate salt |