Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate
Modify Date: 2025-09-11 16:41:06
Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate structure
|
Common Name | Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2126159-69-9 | Molecular Weight | 160.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5LiN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5LiN2O3 |
|---|---|
| Molecular Weight | 160.1 |
| InChIKey | OXSLRRDZDLHIJF-UHFFFAOYSA-M |
| SMILES | O=C([O-])c1noc(C2CC2)n1.[Li+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: Molecular weight of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is 160.1. |
| Q: What is the CAS number of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: CAS number of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is 2126159-69-9. |
| Q: What is the English name of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: The English name of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate. |
| Q: What is the InChIKey of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: InChIKey of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is OXSLRRDZDLHIJF-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 2126159-69-9? |
| A: Chinese name of 2126159-69-9 is 2126159-69-9. |
| Q: What is the SMILES notation of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: SMILES notation of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is O=C([O-])c1noc(C2CC2)n1.[Li+]. |
| Q: What is the molecular formula of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate? |
| A: Molecular formula of Lithium 5-cyclopropyl-1,2,4-oxadiazole-3-carboxylate is C6H5LiN2O3. |