1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate
Modify Date: 2025-09-16 20:50:23
1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate structure
|
Common Name | 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2126159-88-2 | Molecular Weight | 418.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21BrClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21BrClNO4 |
|---|---|
| Molecular Weight | 418.7 |
| InChIKey | VLIITPXHANWHTA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccc(Br)cc2Cl)CCN(C(=O)OC(C)(C)C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: CAS number of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is 2126159-88-2. |
| Q: What is the Chinese name of 2126159-88-2? |
| A: Chinese name of 2126159-88-2 is 2126159-88-2. |
| Q: What is the SMILES notation of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: SMILES notation of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is COC(=O)C1(c2ccc(Br)cc2Cl)CCN(C(=O)OC(C)(C)C)C1. |
| Q: What is the English name of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: The English name of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate. |
| Q: What is the InChIKey of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: InChIKey of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is VLIITPXHANWHTA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: Molecular formula of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is C17H21BrClNO4. |
| Q: What is the molecular weight of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate? |
| A: Molecular weight of 1-(tert-Butyl) 3-methyl 3-(4-bromo-2-chlorophenyl)pyrrolidine-1,3-dicarboxylate is 418.7. |