2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride
Modify Date: 2026-07-14 17:27:25
![2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride Structure](https://www.chemsrc.com/extcaspic/065/2126159-93-9.png)
2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride structure
|
Common Name | 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2126159-93-9 | Molecular Weight | 227.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClN3O2 |
|---|---|
| Molecular Weight | 227.65 |
| InChIKey | JCKHBUJYKUNTRR-UHFFFAOYSA-N |
| SMILES | Cc1nn(CC(=O)O)c2ncccc12.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: Molecular weight of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is 227.65. |
| Q: What is the CAS number of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: CAS number of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is 2126159-93-9. |
| Q: What is the SMILES notation of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: SMILES notation of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is Cc1nn(CC(=O)O)c2ncccc12.Cl. |
| Q: What is the English name of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: The English name of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride. |
| Q: What is the Chinese name of 2126159-93-9? |
| A: Chinese name of 2126159-93-9 is 2126159-93-9. |
| Q: What is the InChIKey of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: InChIKey of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is JCKHBUJYKUNTRR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride? |
| A: Molecular formula of 2-{3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid hydrochloride is C9H10ClN3O2. |