3'-F-3'-dA(Bz)-2'-Phosphoramidite
Modify Date: 2025-08-25 11:02:00
3'-F-3'-dA(Bz)-2'-Phosphoramidite structure
|
Common Name | 3'-F-3'-dA(Bz)-2'-Phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 2127174-09-6 | Molecular Weight | 875.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H51FN7O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-F-3'-dA(Bz)-2'-Phosphoramidite3'-F-3'-dA(Bz)-2'-Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | 3'-F-3'-dA(Bz)-2'-Phosphoramidite |
|---|
| Description | 3'-F-3'-dA(Bz)-2'-Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C47H51FN7O7P |
|---|---|
| Molecular Weight | 875.92 |
| InChIKey | WTXSTLCSPVTJTM-MSIRFHFKSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C(OP(OCCC#N)N(C(C)C)C(C)C)C2F)(c2ccccc2)c2ccc(OC)cc2)cc1 |