Cowaxanthone B structure
|
Common Name | Cowaxanthone B | ||
|---|---|---|---|---|
| CAS Number | 212842-64-3 | Molecular Weight | 424.486 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 621.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4±25.0 °C | |
Use of Cowaxanthone BCowaxanthone B is a xanthone isolated from the fruits of Garcinia cowa. Cowaxanthone B has weak antibacterial activity[1]. |
| Name | 1,3-Dihydroxy-6,7-dimethoxy-2,8-bis(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Cowaxanthone B is a xanthone isolated from the fruits of Garcinia cowa. Cowaxanthone B has weak antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.9±55.0 °C at 760 mmHg |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.486 |
| Flash Point | 210.4±25.0 °C |
| Exact Mass | 424.188599 |
| LogP | 6.04 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | BLZDSTHKFQEOIU-UHFFFAOYSA-N |
| SMILES | COc1cc2oc3cc(O)c(CC=C(C)C)c(O)c3c(=O)c2c(CC=C(C)C)c1OC |
| Storage condition | 2-8℃ |
| 1,3-Dihydroxy-6,7-dimethoxy-2,8-bis(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
| MFCD28350932 |
| 9H-Xanthen-9-one, 1,3-dihydroxy-6,7-dimethoxy-2,8-bis(3-methyl-2-buten-1-yl)- |