N-[2,4-dinitro-5-(trifluoromethyl)phenyl]-2,4-dinitro-5-(trifluoromethyl)aniline structure
|
Common Name | N-[2,4-dinitro-5-(trifluoromethyl)phenyl]-2,4-dinitro-5-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 21299-50-3 | Molecular Weight | 485.20900 | |
| Density | 1.797g/cm3 | Boiling Point | 508.7ºC at 760 mmHg | |
| Molecular Formula | C14H5F6N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4ºC | |
| Name | N-[2,4-dinitro-5-(trifluoromethyl)phenyl]-2,4-dinitro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.797g/cm3 |
|---|---|
| Boiling Point | 508.7ºC at 760 mmHg |
| Molecular Formula | C14H5F6N5O8 |
| Molecular Weight | 485.20900 |
| Flash Point | 261.4ºC |
| Exact Mass | 485.00400 |
| PSA | 195.31000 |
| LogP | 7.26640 |
| Vapour Pressure | 1.82E-10mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | NVAIVPBZWLNGRV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(C(F)(F)F)cc1Nc1cc(C(F)(F)F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,3'-Bis-trifluormethyl-tetranitrodiphenylamin |