6,8-Dimethylquinoline-3-carboxylic acid structure
|
Common Name | 6,8-Dimethylquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 213013-16-2 | Molecular Weight | 201.22100 | |
| Density | 1.243g/cm3 | Boiling Point | 374.9ºC at 760 mmHg | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5ºC | |
| Name | 6,8-Dimethylquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760 mmHg |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22100 |
| Flash Point | 180.5ºC |
| Exact Mass | 201.07900 |
| PSA | 50.19000 |
| LogP | 2.54980 |
| Vapour Pressure | 2.75E-06mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | BWNQJFIJKMZWGM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2ncc(C(=O)O)cc2c1 |
| Storage condition | 2-8℃ |
| HS Code | 2933499090 |
|---|
|
~%
6,8-Dimethylqui... CAS#:213013-16-2 |
| Literature: Rao, V. V. Ramana; Fulloon, Belinda E.; Bernhardt, Paul V.; Koch, Rainer; Wentrup, Curt Journal of Organic Chemistry, 1998 , vol. 63, # 17 p. 5779 - 5786 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD09787810 |