1H-Purine-2,6-dione,9-(4-chlorophenyl)-3,9-dihydro- structure
|
Common Name | 1H-Purine-2,6-dione,9-(4-chlorophenyl)-3,9-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 21314-10-3 | Molecular Weight | 262.65200 | |
| Density | 1.71g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-(4-chlorophenyl)-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Molecular Formula | C11H7ClN4O2 |
| Molecular Weight | 262.65200 |
| Exact Mass | 262.02600 |
| PSA | 83.54000 |
| LogP | 1.05550 |
| Index of Refraction | 1.793 |
| InChIKey | GDPWJVYHZWPCCN-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2ncn(-c3ccc(Cl)cc3)c2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Purine-2,6-d... CAS#:21314-10-3 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-(4-chloro-phenyl)-3,9-dihydro-purine-2,6-dione |
| 9-(4-Chlor-phenyl)-3,9-dihydro-purin-2,6-dion |
| 9-(4-chlorophenyl)-3,9-dihydro-1h-purine-2,6-dione |