N(2)-(p-n-Butylphenyl)guanine structure
|
Common Name | N(2)-(p-n-Butylphenyl)guanine | ||
|---|---|---|---|---|
| CAS Number | 21318-90-1 | Molecular Weight | 283.32800 | |
| Density | 1.37g/cm3 | Boiling Point | 521.1ºC at 760 mmHg | |
| Molecular Formula | C15H17N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269ºC | |
| Name | 2-amino-9-(4-butylphenyl)-3H-purin-6-one |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 521.1ºC at 760 mmHg |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.32800 |
| Flash Point | 269ºC |
| Exact Mass | 283.14300 |
| PSA | 89.59000 |
| LogP | 2.61480 |
| Vapour Pressure | 5.85E-11mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | AAMKCWPTVSJLCN-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)N2C=NC3=C2N=C(NC3=O)N |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |