N-[4-(cinnamylideneamino)piperazin-1-yl]-3-phenyl-prop-2-en-1-imine structure
|
Common Name | N-[4-(cinnamylideneamino)piperazin-1-yl]-3-phenyl-prop-2-en-1-imine | ||
|---|---|---|---|---|
| CAS Number | 21323-11-5 | Molecular Weight | 344.45300 | |
| Density | 1.037g/cm3 | Boiling Point | 519.863ºC at 760 mmHg | |
| Molecular Formula | C22H24N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.204ºC | |
| Name | N-[4-(cinnamylideneamino)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 519.863ºC at 760 mmHg |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.45300 |
| Flash Point | 268.204ºC |
| Exact Mass | 344.20000 |
| PSA | 31.20000 |
| LogP | 3.87820 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | TWTJAKPOILRVIW-UHFFFAOYSA-N |
| SMILES | C(=Cc1ccccc1)C=NN1CCN(N=CC=Cc2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N'-bis-(3-phenyl-allylidene)-piperazine-1,4-diamine |
| N-[4-(CINNAMYLIDENEAMINO)PIPERAZIN-1-YL]-3-PHENYL-PROP-2-EN-1-IMINE |